C13H17F3N2O2S — CID 79884964
3-amino-N-cyclopropyl-2,5-dimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 79884964) has the molecular formula C13H17F3N2O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-2,5-dimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 3-amino-N-cyclopropyl-2,5-dimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79884964 |
| Molecular Formula | C13H17F3N2O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3-amino-N-cyclopropyl-2,5-dimethyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | Cc1cc(N)c(C)c(S(=O)(=O)N(CC(F)(F)F)C2CC2)c1 |
| InChI | InChI=1S/C13H17F3N2O2S/c1-8-5-11(17)9(2)12(6-8)21(19,20)18(10-3-4-10)7-13(14,15)16/h5-6,10H,3-4,7,17H2,1-2H3 |
| InChIKey | IEVKTLDELUWBQC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|