C10H14N4O3S — CID 79886082
2-[(4-hydrazinyl-2-pyridinyl)methyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one (PubChem CID 79886082) has the molecular formula C10H14N4O3S and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-[(4-hydrazinyl-2-pyridinyl)methyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one.
| Compound Name | 2-[(4-hydrazinyl-2-pyridinyl)methyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
|---|---|
| PubChem CID | 79886082 |
| Molecular Formula | C10H14N4O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-[(4-hydrazinyl-2-pyridinyl)methyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
| SMILES | CC1(C)C(=O)N(Cc2cc(NN)ccn2)S1(=O)=O |
| InChI | InChI=1S/C10H14N4O3S/c1-10(2)9(15)14(18(10,16)17)6-8-5-7(13-11)3-4-12-8/h3-5H,6,11H2,1-2H3,(H,12,13) |
| InChIKey | MRIOEJBWHCJZBM-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|