About 2-(4-hydroxybutyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one
2-(4-hydroxybutyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one (PubChem CID 79886167) has the molecular formula C8H15NO4S
and a molecular weight of 221.28 g/mol. Its IUPAC name is 2-(4-hydroxybutyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one.
Molecular Properties
| Compound Name | 2-(4-hydroxybutyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
| PubChem CID | 79886167 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-(4-hydroxybutyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
| SMILES | CC1(C)C(=O)N(CCCCO)S1(=O)=O |
| InChI | InChI=1S/C8H15NO4S/c1-8(2)7(11)9(14(8,12)13)5-3-4-6-10/h10H,3-6H2,1-2H3 |
| InChIKey | SGOMFKLFMBYHOF-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-hydroxybutyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxybutyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
The IUPAC name of 2-(4-hydroxybutyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one (CID 79886167) is 2-(4-hydroxybutyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one.
What is the SMILES notation for 2-(4-hydroxybutyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
The canonical SMILES for 2-(4-hydroxybutyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one is CC1(C)C(=O)N(CCCCO)S1(=O)=O.
What is the InChIKey of 2-(4-hydroxybutyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
The InChIKey is SGOMFKLFMBYHOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4S/c1-8(2)7(11)9(14(8,12)13)5-3-4-6-10/h10H,3-6H2,1-2H3.
What are the key properties of 2-(4-hydroxybutyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
2-(4-hydroxybutyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one has a molecular weight of 221.28 g/mol, XLogP of -0.29, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxybutyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one is sourced from PubChem (CID 79886167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).