About 4-[4-(aminomethyl)-2,6-difluorophenoxy]-1,1-dioxothiolan-3-ol
4-[4-(aminomethyl)-2,6-difluorophenoxy]-1,1-dioxothiolan-3-ol (PubChem CID 79886218) has the molecular formula C11H13F2NO4S
and a molecular weight of 293.29 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-2,6-difluorophenoxy]-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-[4-(aminomethyl)-2,6-difluorophenoxy]-1,1-dioxothiolan-3-ol |
| PubChem CID | 79886218 |
| Molecular Formula | C11H13F2NO4S |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 4-[4-(aminomethyl)-2,6-difluorophenoxy]-1,1-dioxothiolan-3-ol |
| SMILES | NCc1cc(F)c(OC2CS(=O)(=O)CC2O)c(F)c1 |
| InChI | InChI=1S/C11H13F2NO4S/c12-7-1-6(3-14)2-8(13)11(7)18-10-5-19(16,17)4-9(10)15/h1-2,9-10,15H,3-5,14H2 |
| InChIKey | VJXZFBSSMKEFQX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(aminomethyl)-2,6-difluorophenoxy]-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(aminomethyl)-2,6-difluorophenoxy]-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-[4-(aminomethyl)-2,6-difluorophenoxy]-1,1-dioxothiolan-3-ol (CID 79886218) is 4-[4-(aminomethyl)-2,6-difluorophenoxy]-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-[4-(aminomethyl)-2,6-difluorophenoxy]-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-[4-(aminomethyl)-2,6-difluorophenoxy]-1,1-dioxothiolan-3-ol is NCc1cc(F)c(OC2CS(=O)(=O)CC2O)c(F)c1.
What is the InChIKey of 4-[4-(aminomethyl)-2,6-difluorophenoxy]-1,1-dioxothiolan-3-ol?
The InChIKey is VJXZFBSSMKEFQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO4S/c12-7-1-6(3-14)2-8(13)11(7)18-10-5-19(16,17)4-9(10)15/h1-2,9-10,15H,3-5,14H2.
What are the key properties of 4-[4-(aminomethyl)-2,6-difluorophenoxy]-1,1-dioxothiolan-3-ol?
4-[4-(aminomethyl)-2,6-difluorophenoxy]-1,1-dioxothiolan-3-ol has a molecular weight of 293.29 g/mol, XLogP of -0.04, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(aminomethyl)-2,6-difluorophenoxy]-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 79886218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).