About 2-[2-(furan-3-ylmethylamino)ethyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one
2-[2-(furan-3-ylmethylamino)ethyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one (PubChem CID 79886436) has the molecular formula C11H16N2O4S
and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-[2-(furan-3-ylmethylamino)ethyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one.
Molecular Properties
| Compound Name | 2-[2-(furan-3-ylmethylamino)ethyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
| PubChem CID | 79886436 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-[2-(furan-3-ylmethylamino)ethyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
| SMILES | CC1(C)C(=O)N(CCNCc2ccoc2)S1(=O)=O |
| InChI | InChI=1S/C11H16N2O4S/c1-11(2)10(14)13(18(11,15)16)5-4-12-7-9-3-6-17-8-9/h3,6,8,12H,4-5,7H2,1-2H3 |
| InChIKey | WPUCIVMSRFCXGO-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(furan-3-ylmethylamino)ethyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(furan-3-ylmethylamino)ethyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
The IUPAC name of 2-[2-(furan-3-ylmethylamino)ethyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one (CID 79886436) is 2-[2-(furan-3-ylmethylamino)ethyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one.
What is the SMILES notation for 2-[2-(furan-3-ylmethylamino)ethyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
The canonical SMILES for 2-[2-(furan-3-ylmethylamino)ethyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one is CC1(C)C(=O)N(CCNCc2ccoc2)S1(=O)=O.
What is the InChIKey of 2-[2-(furan-3-ylmethylamino)ethyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
The InChIKey is WPUCIVMSRFCXGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4S/c1-11(2)10(14)13(18(11,15)16)5-4-12-7-9-3-6-17-8-9/h3,6,8,12H,4-5,7H2,1-2H3.
What are the key properties of 2-[2-(furan-3-ylmethylamino)ethyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
2-[2-(furan-3-ylmethylamino)ethyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one has a molecular weight of 272.33 g/mol, XLogP of 0.32, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(furan-3-ylmethylamino)ethyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one is sourced from PubChem (CID 79886436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).