C11H13N3O3S2 — CID 79886774
3-[(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)methyl]pyridine-2-carbothioamide (PubChem CID 79886774) has the molecular formula C11H13N3O3S2 and a molecular weight of 299.38 g/mol. Its IUPAC name is 3-[(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)methyl]pyridine-2-carbothioamide.
| Compound Name | 3-[(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)methyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 79886774 |
| Molecular Formula | C11H13N3O3S2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-[(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)methyl]pyridine-2-carbothioamide |
| SMILES | CC1(C)C(=O)N(Cc2cccnc2C(N)=S)S1(=O)=O |
| InChI | InChI=1S/C11H13N3O3S2/c1-11(2)10(15)14(19(11,16)17)6-7-4-3-5-13-8(7)9(12)18/h3-5H,6H2,1-2H3,(H2,12,18) |
| InChIKey | DBNKAEQZERDSHM-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|