About 2-[2-(bromomethyl)-3-methylbutyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one
2-[2-(bromomethyl)-3-methylbutyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one (PubChem CID 79886941) has the molecular formula C10H18BrNO3S
and a molecular weight of 312.23 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-3-methylbutyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one.
Molecular Properties
| Compound Name | 2-[2-(bromomethyl)-3-methylbutyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
| PubChem CID | 79886941 |
| Molecular Formula | C10H18BrNO3S |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 2-[2-(bromomethyl)-3-methylbutyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
| SMILES | CC(C)C(CBr)CN1C(=O)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C10H18BrNO3S/c1-7(2)8(5-11)6-12-9(13)10(3,4)16(12,14)15/h7-8H,5-6H2,1-4H3 |
| InChIKey | ZORBXQPSQJZIKW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(bromomethyl)-3-methylbutyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(bromomethyl)-3-methylbutyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
The IUPAC name of 2-[2-(bromomethyl)-3-methylbutyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one (CID 79886941) is 2-[2-(bromomethyl)-3-methylbutyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one.
What is the SMILES notation for 2-[2-(bromomethyl)-3-methylbutyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
The canonical SMILES for 2-[2-(bromomethyl)-3-methylbutyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one is CC(C)C(CBr)CN1C(=O)C(C)(C)S1(=O)=O.
What is the InChIKey of 2-[2-(bromomethyl)-3-methylbutyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
The InChIKey is ZORBXQPSQJZIKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18BrNO3S/c1-7(2)8(5-11)6-12-9(13)10(3,4)16(12,14)15/h7-8H,5-6H2,1-4H3.
What are the key properties of 2-[2-(bromomethyl)-3-methylbutyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one?
2-[2-(bromomethyl)-3-methylbutyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one has a molecular weight of 312.23 g/mol, XLogP of 1.60, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(bromomethyl)-3-methylbutyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one is sourced from PubChem (CID 79886941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).