2,2-dimethylpyrrolidine-1-carbonyl chloride

C7H12ClNO — CID 79887171

IUPAC2,2-dimethylpyrrolidine-1-carbonyl chloride
SMILESCC1(C)CCCN1C(=O)Cl
InChIInChI=1S/C7H12ClNO/c1-7(2)4-3-5-9(7)6(8)10/h3-5H2,1-2H3
InChIKeyZLWCGSZACCSMTG-UHFFFAOYSA-N
MW161.63 g/mol
LogP2.22
Rot. Bonds

About 2,2-dimethylpyrrolidine-1-carbonyl chloride

2,2-dimethylpyrrolidine-1-carbonyl chloride (PubChem CID 79887171) has the molecular formula C7H12ClNO and a molecular weight of 161.63 g/mol. Its IUPAC name is 2,2-dimethylpyrrolidine-1-carbonyl chloride.

Molecular Properties

Compound Name2,2-dimethylpyrrolidine-1-carbonyl chloride
PubChem CID79887171
Molecular FormulaC7H12ClNO
Molecular Weight161.63 g/mol
Exact Mass161.06
IUPAC Name2,2-dimethylpyrrolidine-1-carbonyl chloride
SMILESCC1(C)CCCN1C(=O)Cl
InChIInChI=1S/C7H12ClNO/c1-7(2)4-3-5-9(7)6(8)10/h3-5H2,1-2H3
InChIKeyZLWCGSZACCSMTG-UHFFFAOYSA-N
XLogP2.22
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.63
LogP ≤ 52.22
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze 2,2-dimethylpyrrolidine-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethylpyrrolidine-1-carbonyl chloride?
The IUPAC name of 2,2-dimethylpyrrolidine-1-carbonyl chloride (CID 79887171) is 2,2-dimethylpyrrolidine-1-carbonyl chloride.
What is the SMILES notation for 2,2-dimethylpyrrolidine-1-carbonyl chloride?
The canonical SMILES for 2,2-dimethylpyrrolidine-1-carbonyl chloride is CC1(C)CCCN1C(=O)Cl.
What is the InChIKey of 2,2-dimethylpyrrolidine-1-carbonyl chloride?
The InChIKey is ZLWCGSZACCSMTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClNO/c1-7(2)4-3-5-9(7)6(8)10/h3-5H2,1-2H3.
What are the key properties of 2,2-dimethylpyrrolidine-1-carbonyl chloride?
2,2-dimethylpyrrolidine-1-carbonyl chloride has a molecular weight of 161.63 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpyrrolidine-1-carbonyl chloride is sourced from PubChem (CID 79887171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).