C9H16BrNO3S — CID 79887209
2-(3-bromo-2,2-dimethylpropyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one (PubChem CID 79887209) has the molecular formula C9H16BrNO3S and a molecular weight of 298.20 g/mol. Its IUPAC name is 2-(3-bromo-2,2-dimethylpropyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one.
| Compound Name | 2-(3-bromo-2,2-dimethylpropyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
|---|---|
| PubChem CID | 79887209 |
| Molecular Formula | C9H16BrNO3S |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 2-(3-bromo-2,2-dimethylpropyl)-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
| SMILES | CC(C)(CBr)CN1C(=O)C(C)(C)S1(=O)=O |
| InChI | InChI=1S/C9H16BrNO3S/c1-8(2,5-10)6-11-7(12)9(3,4)15(11,13)14/h5-6H2,1-4H3 |
| InChIKey | SCSJZVDYFQCTPO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|