methyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate

C10H8F2O2S — CID 79888762

IUPACmethyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate
SMILESCOC(=O)C=CSc1ccc(F)c(F)c1
InChIInChI=1S/C10H8F2O2S/c1-14-10(13)4-5-15-7-2-3-8(11)9(12)6-7/h2-6H,1H3
InChIKeyYCZFUQBFBCFUND-UHFFFAOYSA-N
MW230.23 g/mol
LogP2.74
Rot. Bonds3

About methyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate

methyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate (PubChem CID 79888762) has the molecular formula C10H8F2O2S and a molecular weight of 230.23 g/mol. Its IUPAC name is methyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate.

Molecular Properties

Compound Namemethyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate
PubChem CID79888762
Molecular FormulaC10H8F2O2S
Molecular Weight230.23 g/mol
Exact Mass230.02
IUPAC Namemethyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate
SMILESCOC(=O)C=CSc1ccc(F)c(F)c1
InChIInChI=1S/C10H8F2O2S/c1-14-10(13)4-5-15-7-2-3-8(11)9(12)6-7/h2-6H,1H3
InChIKeyYCZFUQBFBCFUND-UHFFFAOYSA-N
XLogP2.74
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.23
LogP ≤ 52.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate?
The IUPAC name of methyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate (CID 79888762) is methyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate.
What is the SMILES notation for methyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate?
The canonical SMILES for methyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate is COC(=O)C=CSc1ccc(F)c(F)c1.
What is the InChIKey of methyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate?
The InChIKey is YCZFUQBFBCFUND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2O2S/c1-14-10(13)4-5-15-7-2-3-8(11)9(12)6-7/h2-6H,1H3.
What are the key properties of methyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate?
methyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate has a molecular weight of 230.23 g/mol, XLogP of 2.74, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,4-difluorophenyl)sulfanylprop-2-enoate is sourced from PubChem (CID 79888762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).