C12H18N2O2S — CID 79889241
3-amino-N-cyclobutyl-2,5-dimethylbenzenesulfonamide (PubChem CID 79889241) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 3-amino-N-cyclobutyl-2,5-dimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-cyclobutyl-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 79889241 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-amino-N-cyclobutyl-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(N)c(C)c(S(=O)(=O)NC2CCC2)c1 |
| InChI | InChI=1S/C12H18N2O2S/c1-8-6-11(13)9(2)12(7-8)17(15,16)14-10-4-3-5-10/h6-7,10,14H,3-5,13H2,1-2H3 |
| InChIKey | IMUZSYUMSGQNLY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|