C12H17F3N2O2S — CID 79889503
3-amino-N,2,5-trimethyl-N-(3,3,3-trifluoropropyl)benzenesulfonamide (PubChem CID 79889503) has the molecular formula C12H17F3N2O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is 3-amino-N,2,5-trimethyl-N-(3,3,3-trifluoropropyl)benzenesulfonamide.
| Compound Name | 3-amino-N,2,5-trimethyl-N-(3,3,3-trifluoropropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79889503 |
| Molecular Formula | C12H17F3N2O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-amino-N,2,5-trimethyl-N-(3,3,3-trifluoropropyl)benzenesulfonamide |
| SMILES | Cc1cc(N)c(C)c(S(=O)(=O)N(C)CCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H17F3N2O2S/c1-8-6-10(16)9(2)11(7-8)20(18,19)17(3)5-4-12(13,14)15/h6-7H,4-5,16H2,1-3H3 |
| InChIKey | NFWXENLQQJFOSV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|