C14H20N4O — CID 79890123
2-N-[(1-methylpiperidin-4-yl)methyl]-1,3-benzoxazole-2,5-diamine (PubChem CID 79890123) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-N-[(1-methylpiperidin-4-yl)methyl]-1,3-benzoxazole-2,5-diamine.
| Compound Name | 2-N-[(1-methylpiperidin-4-yl)methyl]-1,3-benzoxazole-2,5-diamine |
|---|---|
| PubChem CID | 79890123 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-N-[(1-methylpiperidin-4-yl)methyl]-1,3-benzoxazole-2,5-diamine |
| SMILES | CN1CCC(CNc2nc3cc(N)ccc3o2)CC1 |
| InChI | InChI=1S/C14H20N4O/c1-18-6-4-10(5-7-18)9-16-14-17-12-8-11(15)2-3-13(12)19-14/h2-3,8,10H,4-7,9,15H2,1H3,(H,16,17) |
| InChIKey | YEHYNSDDZZWLSM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 67.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|