About 2-[4-(trifluoromethyl)piperidin-1-yl]-1,3-benzoxazol-5-amine
2-[4-(trifluoromethyl)piperidin-1-yl]-1,3-benzoxazol-5-amine (PubChem CID 79890290) has the molecular formula C13H14F3N3O
and a molecular weight of 285.27 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)piperidin-1-yl]-1,3-benzoxazol-5-amine.
Molecular Properties
| Compound Name | 2-[4-(trifluoromethyl)piperidin-1-yl]-1,3-benzoxazol-5-amine |
| PubChem CID | 79890290 |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-[4-(trifluoromethyl)piperidin-1-yl]-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(N3CCC(C(F)(F)F)CC3)nc2c1 |
| InChI | InChI=1S/C13H14F3N3O/c14-13(15,16)8-3-5-19(6-4-8)12-18-10-7-9(17)1-2-11(10)20-12/h1-2,7-8H,3-6,17H2 |
| InChIKey | OUQUCTAUUAQCIY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(trifluoromethyl)piperidin-1-yl]-1,3-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(trifluoromethyl)piperidin-1-yl]-1,3-benzoxazol-5-amine?
The IUPAC name of 2-[4-(trifluoromethyl)piperidin-1-yl]-1,3-benzoxazol-5-amine (CID 79890290) is 2-[4-(trifluoromethyl)piperidin-1-yl]-1,3-benzoxazol-5-amine.
What is the SMILES notation for 2-[4-(trifluoromethyl)piperidin-1-yl]-1,3-benzoxazol-5-amine?
The canonical SMILES for 2-[4-(trifluoromethyl)piperidin-1-yl]-1,3-benzoxazol-5-amine is Nc1ccc2oc(N3CCC(C(F)(F)F)CC3)nc2c1.
What is the InChIKey of 2-[4-(trifluoromethyl)piperidin-1-yl]-1,3-benzoxazol-5-amine?
The InChIKey is OUQUCTAUUAQCIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3N3O/c14-13(15,16)8-3-5-19(6-4-8)12-18-10-7-9(17)1-2-11(10)20-12/h1-2,7-8H,3-6,17H2.
What are the key properties of 2-[4-(trifluoromethyl)piperidin-1-yl]-1,3-benzoxazol-5-amine?
2-[4-(trifluoromethyl)piperidin-1-yl]-1,3-benzoxazol-5-amine has a molecular weight of 285.27 g/mol, XLogP of 3.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(trifluoromethyl)piperidin-1-yl]-1,3-benzoxazol-5-amine is sourced from PubChem (CID 79890290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).