About 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethanol
2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethanol (PubChem CID 79890543) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethanol |
| PubChem CID | 79890543 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethanol |
| SMILES | Nc1cccc2oc(NCCO)nc12 |
| InChI | InChI=1S/C9H11N3O2/c10-6-2-1-3-7-8(6)12-9(14-7)11-4-5-13/h1-3,13H,4-5,10H2,(H,11,12) |
| InChIKey | AQBZULQIKZJQGE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethanol?
The IUPAC name of 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethanol (CID 79890543) is 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethanol.
What is the SMILES notation for 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethanol?
The canonical SMILES for 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethanol is Nc1cccc2oc(NCCO)nc12.
What is the InChIKey of 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethanol?
The InChIKey is AQBZULQIKZJQGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c10-6-2-1-3-7-8(6)12-9(14-7)11-4-5-13/h1-3,13H,4-5,10H2,(H,11,12).
What are the key properties of 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethanol?
2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethanol has a molecular weight of 193.21 g/mol, XLogP of 0.81, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1,3-benzoxazol-2-yl)amino]ethanol is sourced from PubChem (CID 79890543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).