About 2-N-(cyclohexylmethyl)-1,3-benzoxazole-2,6-diamine
2-N-(cyclohexylmethyl)-1,3-benzoxazole-2,6-diamine (PubChem CID 79891086) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-N-(cyclohexylmethyl)-1,3-benzoxazole-2,6-diamine.
Molecular Properties
| Compound Name | 2-N-(cyclohexylmethyl)-1,3-benzoxazole-2,6-diamine |
| PubChem CID | 79891086 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-N-(cyclohexylmethyl)-1,3-benzoxazole-2,6-diamine |
| SMILES | Nc1ccc2nc(NCC3CCCCC3)oc2c1 |
| InChI | InChI=1S/C14H19N3O/c15-11-6-7-12-13(8-11)18-14(17-12)16-9-10-4-2-1-3-5-10/h6-8,10H,1-5,9,15H2,(H,16,17) |
| InChIKey | BJRDOJVKCGCEHY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(cyclohexylmethyl)-1,3-benzoxazole-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(cyclohexylmethyl)-1,3-benzoxazole-2,6-diamine?
The IUPAC name of 2-N-(cyclohexylmethyl)-1,3-benzoxazole-2,6-diamine (CID 79891086) is 2-N-(cyclohexylmethyl)-1,3-benzoxazole-2,6-diamine.
What is the SMILES notation for 2-N-(cyclohexylmethyl)-1,3-benzoxazole-2,6-diamine?
The canonical SMILES for 2-N-(cyclohexylmethyl)-1,3-benzoxazole-2,6-diamine is Nc1ccc2nc(NCC3CCCCC3)oc2c1.
What is the InChIKey of 2-N-(cyclohexylmethyl)-1,3-benzoxazole-2,6-diamine?
The InChIKey is BJRDOJVKCGCEHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O/c15-11-6-7-12-13(8-11)18-14(17-12)16-9-10-4-2-1-3-5-10/h6-8,10H,1-5,9,15H2,(H,16,17).
What are the key properties of 2-N-(cyclohexylmethyl)-1,3-benzoxazole-2,6-diamine?
2-N-(cyclohexylmethyl)-1,3-benzoxazole-2,6-diamine has a molecular weight of 245.33 g/mol, XLogP of 3.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(cyclohexylmethyl)-1,3-benzoxazole-2,6-diamine is sourced from PubChem (CID 79891086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).