C12H15N3O3 — CID 79891097
2-N-(1,4-dioxan-2-ylmethyl)-1,3-benzoxazole-2,6-diamine (PubChem CID 79891097) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-N-(1,4-dioxan-2-ylmethyl)-1,3-benzoxazole-2,6-diamine.
| Compound Name | 2-N-(1,4-dioxan-2-ylmethyl)-1,3-benzoxazole-2,6-diamine |
|---|---|
| PubChem CID | 79891097 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2-N-(1,4-dioxan-2-ylmethyl)-1,3-benzoxazole-2,6-diamine |
| SMILES | Nc1ccc2nc(NCC3COCCO3)oc2c1 |
| InChI | InChI=1S/C12H15N3O3/c13-8-1-2-10-11(5-8)18-12(15-10)14-6-9-7-16-3-4-17-9/h1-2,5,9H,3-4,6-7,13H2,(H,14,15) |
| InChIKey | TXJBLHQBYMPRLA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|