C12H11F2N3O2 — CID 79892222
4-[(4,5-dimethyl-1,2,4-triazol-3-yl)methoxy]-3,5-difluorobenzaldehyde (PubChem CID 79892222) has the molecular formula C12H11F2N3O2 and a molecular weight of 267.23 g/mol. Its IUPAC name is 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)methoxy]-3,5-difluorobenzaldehyde.
| Compound Name | 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)methoxy]-3,5-difluorobenzaldehyde |
|---|---|
| PubChem CID | 79892222 |
| Molecular Formula | C12H11F2N3O2 |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 4-[(4,5-dimethyl-1,2,4-triazol-3-yl)methoxy]-3,5-difluorobenzaldehyde |
| SMILES | Cc1nnc(COc2c(F)cc(C=O)cc2F)n1C |
| InChI | InChI=1S/C12H11F2N3O2/c1-7-15-16-11(17(7)2)6-19-12-9(13)3-8(5-18)4-10(12)14/h3-5H,6H2,1-2H3 |
| InChIKey | GECJZHOBNGZBGT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|