C13H19N3O — CID 79892513
2-N-(2,3-dimethylbutyl)-1,3-benzoxazole-2,4-diamine (PubChem CID 79892513) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-N-(2,3-dimethylbutyl)-1,3-benzoxazole-2,4-diamine.
| Compound Name | 2-N-(2,3-dimethylbutyl)-1,3-benzoxazole-2,4-diamine |
|---|---|
| PubChem CID | 79892513 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-N-(2,3-dimethylbutyl)-1,3-benzoxazole-2,4-diamine |
| SMILES | CC(C)C(C)CNc1nc2c(N)cccc2o1 |
| InChI | InChI=1S/C13H19N3O/c1-8(2)9(3)7-15-13-16-12-10(14)5-4-6-11(12)17-13/h4-6,8-9H,7,14H2,1-3H3,(H,15,16) |
| InChIKey | QVZAQILVJIJSHM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|