C13H9Cl2N3O — CID 79892518
2-N-(2,6-dichlorophenyl)-1,3-benzoxazole-2,4-diamine (PubChem CID 79892518) has the molecular formula C13H9Cl2N3O and a molecular weight of 294.14 g/mol. Its IUPAC name is 2-N-(2,6-dichlorophenyl)-1,3-benzoxazole-2,4-diamine.
| Compound Name | 2-N-(2,6-dichlorophenyl)-1,3-benzoxazole-2,4-diamine |
|---|---|
| PubChem CID | 79892518 |
| Molecular Formula | C13H9Cl2N3O |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 2-N-(2,6-dichlorophenyl)-1,3-benzoxazole-2,4-diamine |
| SMILES | Nc1cccc2oc(Nc3c(Cl)cccc3Cl)nc12 |
| InChI | InChI=1S/C13H9Cl2N3O/c14-7-3-1-4-8(15)11(7)17-13-18-12-9(16)5-2-6-10(12)19-13/h1-6H,16H2,(H,17,18) |
| InChIKey | HXTDUOIXWGSMHZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|