C13H14N4OS — CID 79892589
2-N-[1-(1,3-thiazol-2-yl)propyl]-1,3-benzoxazole-2,6-diamine (PubChem CID 79892589) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is 2-N-[1-(1,3-thiazol-2-yl)propyl]-1,3-benzoxazole-2,6-diamine.
| Compound Name | 2-N-[1-(1,3-thiazol-2-yl)propyl]-1,3-benzoxazole-2,6-diamine |
|---|---|
| PubChem CID | 79892589 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2-N-[1-(1,3-thiazol-2-yl)propyl]-1,3-benzoxazole-2,6-diamine |
| SMILES | CCC(Nc1nc2ccc(N)cc2o1)c1nccs1 |
| InChI | InChI=1S/C13H14N4OS/c1-2-9(12-15-5-6-19-12)16-13-17-10-4-3-8(14)7-11(10)18-13/h3-7,9H,2,14H2,1H3,(H,16,17) |
| InChIKey | XWCQPFWRCBRVRB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|