C15H17N3OS — CID 79892758
2-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-benzoxazole-2,6-diamine (PubChem CID 79892758) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 2-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-benzoxazole-2,6-diamine.
| Compound Name | 2-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-benzoxazole-2,6-diamine |
|---|---|
| PubChem CID | 79892758 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-N-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-benzoxazole-2,6-diamine |
| SMILES | Cc1cc(C(C)Nc2nc3ccc(N)cc3o2)c(C)s1 |
| InChI | InChI=1S/C15H17N3OS/c1-8-6-12(10(3)20-8)9(2)17-15-18-13-5-4-11(16)7-14(13)19-15/h4-7,9H,16H2,1-3H3,(H,17,18) |
| InChIKey | OPXAPNKCKPCCKT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|