C15H21N3O — CID 79892955
2-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1,3-benzoxazole-2,4-diamine (PubChem CID 79892955) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1,3-benzoxazole-2,4-diamine.
| Compound Name | 2-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1,3-benzoxazole-2,4-diamine |
|---|---|
| PubChem CID | 79892955 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2-N-[(2,2,3,3-tetramethylcyclopropyl)methyl]-1,3-benzoxazole-2,4-diamine |
| SMILES | CC1(C)C(CNc2nc3c(N)cccc3o2)C1(C)C |
| InChI | InChI=1S/C15H21N3O/c1-14(2)11(15(14,3)4)8-17-13-18-12-9(16)6-5-7-10(12)19-13/h5-7,11H,8,16H2,1-4H3,(H,17,18) |
| InChIKey | HVVMBPKLGBMCTI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|