C14H16N4OS — CID 79893422
2-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1,3-benzoxazole-2,4-diamine (PubChem CID 79893422) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is 2-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1,3-benzoxazole-2,4-diamine.
| Compound Name | 2-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1,3-benzoxazole-2,4-diamine |
|---|---|
| PubChem CID | 79893422 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1,3-benzoxazole-2,4-diamine |
| SMILES | Cc1nc(C)c(C(C)Nc2nc3c(N)cccc3o2)s1 |
| InChI | InChI=1S/C14H16N4OS/c1-7-13(20-9(3)16-7)8(2)17-14-18-12-10(15)5-4-6-11(12)19-14/h4-6,8H,15H2,1-3H3,(H,17,18) |
| InChIKey | WNBHPFQWTGXPPB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|