C14H23N3OS — CID 79894810
N-[2-(1-methylimidazol-2-yl)ethyl]-6-oxa-2-thiaspiro[4.5]decan-9-amine (PubChem CID 79894810) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is N-[2-(1-methylimidazol-2-yl)ethyl]-6-oxa-2-thiaspiro[4.5]decan-9-amine.
| Compound Name | N-[2-(1-methylimidazol-2-yl)ethyl]-6-oxa-2-thiaspiro[4.5]decan-9-amine |
|---|---|
| PubChem CID | 79894810 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-[2-(1-methylimidazol-2-yl)ethyl]-6-oxa-2-thiaspiro[4.5]decan-9-amine |
| SMILES | Cn1ccnc1CCNC1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C14H23N3OS/c1-17-7-6-16-13(17)2-5-15-12-3-8-18-14(10-12)4-9-19-11-14/h6-7,12,15H,2-5,8-11H2,1H3 |
| InChIKey | SFFJKBLYULOTKH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |