C15H27NO2 — CID 79895145
N-(1-methylcyclopentyl)-1,9-dioxaspiro[5.5]undecan-4-amine (PubChem CID 79895145) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is N-(1-methylcyclopentyl)-1,9-dioxaspiro[5.5]undecan-4-amine.
| Compound Name | N-(1-methylcyclopentyl)-1,9-dioxaspiro[5.5]undecan-4-amine |
|---|---|
| PubChem CID | 79895145 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | N-(1-methylcyclopentyl)-1,9-dioxaspiro[5.5]undecan-4-amine |
| SMILES | CC1(NC2CCOC3(CCOCC3)C2)CCCC1 |
| InChI | InChI=1S/C15H27NO2/c1-14(5-2-3-6-14)16-13-4-9-18-15(12-13)7-10-17-11-8-15/h13,16H,2-12H2,1H3 |
| InChIKey | CRBZGEINZCQXAR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |