C15H30N2OS — CID 79895464
N',N'-dimethyl-N-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)butane-1,4-diamine (PubChem CID 79895464) has the molecular formula C15H30N2OS and a molecular weight of 286.48 g/mol. Its IUPAC name is N',N'-dimethyl-N-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)butane-1,4-diamine.
| Compound Name | N',N'-dimethyl-N-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 79895464 |
| Molecular Formula | C15H30N2OS |
| Molecular Weight | 286.48 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | N',N'-dimethyl-N-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)butane-1,4-diamine |
| SMILES | CN(C)CCCCNC1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C15H30N2OS/c1-17(2)9-4-3-8-16-14-5-10-18-15(13-14)6-11-19-12-7-15/h14,16H,3-13H2,1-2H3 |
| InChIKey | DAXPCYHYOAKLCZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|