C10H11FN4O2S — CID 79895976
5-amino-3-fluoro-N-(1H-imidazol-2-yl)-2-methylbenzenesulfonamide (PubChem CID 79895976) has the molecular formula C10H11FN4O2S and a molecular weight of 270.29 g/mol. Its IUPAC name is 5-amino-3-fluoro-N-(1H-imidazol-2-yl)-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-3-fluoro-N-(1H-imidazol-2-yl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79895976 |
| Molecular Formula | C10H11FN4O2S |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 5-amino-3-fluoro-N-(1H-imidazol-2-yl)-2-methylbenzenesulfonamide |
| SMILES | Cc1c(F)cc(N)cc1S(=O)(=O)Nc1ncc[nH]1 |
| InChI | InChI=1S/C10H11FN4O2S/c1-6-8(11)4-7(12)5-9(6)18(16,17)15-10-13-2-3-14-10/h2-5H,12H2,1H3,(H2,13,14,15) |
| InChIKey | AIGPOHYQBDLKLJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|