3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid

C8H12F3NO2 — CID 79895999

IUPAC3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid
SMILESCC(C)N(C=CC(=O)O)CC(F)(F)F
InChIInChI=1S/C8H12F3NO2/c1-6(2)12(4-3-7(13)14)5-8(9,10)11/h3-4,6H,5H2,1-2H3,(H,13,14)
InChIKeyMAUFAXNCCXSTRK-UHFFFAOYSA-N
MW211.18 g/mol
LogP1.86
Rot. Bonds4

About 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid

3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid (PubChem CID 79895999) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid.

Molecular Properties

Compound Name3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid
PubChem CID79895999
Molecular FormulaC8H12F3NO2
Molecular Weight211.18 g/mol
Exact Mass211.08
IUPAC Name3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid
SMILESCC(C)N(C=CC(=O)O)CC(F)(F)F
InChIInChI=1S/C8H12F3NO2/c1-6(2)12(4-3-7(13)14)5-8(9,10)11/h3-4,6H,5H2,1-2H3,(H,13,14)
InChIKeyMAUFAXNCCXSTRK-UHFFFAOYSA-N
XLogP1.86
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.18
LogP ≤ 51.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid?
The IUPAC name of 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid (CID 79895999) is 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid.
What is the SMILES notation for 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid?
The canonical SMILES for 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid is CC(C)N(C=CC(=O)O)CC(F)(F)F.
What is the InChIKey of 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid?
The InChIKey is MAUFAXNCCXSTRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3NO2/c1-6(2)12(4-3-7(13)14)5-8(9,10)11/h3-4,6H,5H2,1-2H3,(H,13,14).
What are the key properties of 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid?
3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid has a molecular weight of 211.18 g/mol, XLogP of 1.86, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]prop-2-enoic acid is sourced from PubChem (CID 79895999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).