C10H14F3N3O2S — CID 79896054
5-amino-2-methyl-3-(3,3,3-trifluoropropylamino)benzenesulfonamide (PubChem CID 79896054) has the molecular formula C10H14F3N3O2S and a molecular weight of 297.30 g/mol. Its IUPAC name is 5-amino-2-methyl-3-(3,3,3-trifluoropropylamino)benzenesulfonamide.
| Compound Name | 5-amino-2-methyl-3-(3,3,3-trifluoropropylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 79896054 |
| Molecular Formula | C10H14F3N3O2S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 5-amino-2-methyl-3-(3,3,3-trifluoropropylamino)benzenesulfonamide |
| SMILES | Cc1c(NCCC(F)(F)F)cc(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H14F3N3O2S/c1-6-8(16-3-2-10(11,12)13)4-7(14)5-9(6)19(15,17)18/h4-5,16H,2-3,14H2,1H3,(H2,15,17,18) |
| InChIKey | BGHSWRDBJMSPID-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|