C11H18N2O2 — CID 79896170
methyl 3-[2-cyanoethyl(2-methylpropyl)amino]prop-2-enoate (PubChem CID 79896170) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is methyl 3-[2-cyanoethyl(2-methylpropyl)amino]prop-2-enoate.
| Compound Name | methyl 3-[2-cyanoethyl(2-methylpropyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 79896170 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | methyl 3-[2-cyanoethyl(2-methylpropyl)amino]prop-2-enoate |
| SMILES | COC(=O)C=CN(CCC#N)CC(C)C |
| InChI | InChI=1S/C11H18N2O2/c1-10(2)9-13(7-4-6-12)8-5-11(14)15-3/h5,8,10H,4,7,9H2,1-3H3 |
| InChIKey | XAUBJCPFGUJIGV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|