3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid

C9H16N2O2 — CID 79896521

IUPAC3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid
SMILESCC1CN(C=CC(=O)O)CCN1C
InChIInChI=1S/C9H16N2O2/c1-8-7-11(4-3-9(12)13)6-5-10(8)2/h3-4,8H,5-7H2,1-2H3,(H,12,13)
InChIKeyOPLCAHYQNLVPLE-UHFFFAOYSA-N
MW184.24 g/mol
LogP0.22
Rot. Bonds2

About 3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid

3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid (PubChem CID 79896521) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid.

Molecular Properties

Compound Name3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid
PubChem CID79896521
Molecular FormulaC9H16N2O2
Molecular Weight184.24 g/mol
Exact Mass184.12
IUPAC Name3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid
SMILESCC1CN(C=CC(=O)O)CCN1C
InChIInChI=1S/C9H16N2O2/c1-8-7-11(4-3-9(12)13)6-5-10(8)2/h3-4,8H,5-7H2,1-2H3,(H,12,13)
InChIKeyOPLCAHYQNLVPLE-UHFFFAOYSA-N
XLogP0.22
TPSA43.78 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.24
LogP ≤ 50.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid?
The IUPAC name of 3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid (CID 79896521) is 3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid.
What is the SMILES notation for 3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid?
The canonical SMILES for 3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid is CC1CN(C=CC(=O)O)CCN1C.
What is the InChIKey of 3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid?
The InChIKey is OPLCAHYQNLVPLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-8-7-11(4-3-9(12)13)6-5-10(8)2/h3-4,8H,5-7H2,1-2H3,(H,12,13).
What are the key properties of 3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid?
3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid has a molecular weight of 184.24 g/mol, XLogP of 0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dimethylpiperazin-1-yl)prop-2-enoic acid is sourced from PubChem (CID 79896521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).