C11H18N2O2 — CID 79896700
3-(3-pyrrolidin-1-ylpyrrolidin-1-yl)prop-2-enoic acid (PubChem CID 79896700) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-(3-pyrrolidin-1-ylpyrrolidin-1-yl)prop-2-enoic acid.
| Compound Name | 3-(3-pyrrolidin-1-ylpyrrolidin-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 79896700 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-(3-pyrrolidin-1-ylpyrrolidin-1-yl)prop-2-enoic acid |
| SMILES | O=C(O)C=CN1CCC(N2CCCC2)C1 |
| InChI | InChI=1S/C11H18N2O2/c14-11(15)4-8-12-7-3-10(9-12)13-5-1-2-6-13/h4,8,10H,1-3,5-7,9H2,(H,14,15) |
| InChIKey | YKEZPBKIQPABGE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|