C11H21NO2 — CID 79896779
methyl 3-[3,3-dimethylbutan-2-yl(methyl)amino]prop-2-enoate (PubChem CID 79896779) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is methyl 3-[3,3-dimethylbutan-2-yl(methyl)amino]prop-2-enoate.
| Compound Name | methyl 3-[3,3-dimethylbutan-2-yl(methyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 79896779 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | methyl 3-[3,3-dimethylbutan-2-yl(methyl)amino]prop-2-enoate |
| SMILES | COC(=O)C=CN(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C11H21NO2/c1-9(11(2,3)4)12(5)8-7-10(13)14-6/h7-9H,1-6H3 |
| InChIKey | SLNFBYSMUFMJGU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|