C9H13FN2O3S — CID 79896813
5-amino-3-fluoro-N-methoxy-N,2-dimethylbenzenesulfonamide (PubChem CID 79896813) has the molecular formula C9H13FN2O3S and a molecular weight of 248.28 g/mol. Its IUPAC name is 5-amino-3-fluoro-N-methoxy-N,2-dimethylbenzenesulfonamide.
| Compound Name | 5-amino-3-fluoro-N-methoxy-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 79896813 |
| Molecular Formula | C9H13FN2O3S |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 5-amino-3-fluoro-N-methoxy-N,2-dimethylbenzenesulfonamide |
| SMILES | CON(C)S(=O)(=O)c1cc(N)cc(F)c1C |
| InChI | InChI=1S/C9H13FN2O3S/c1-6-8(10)4-7(11)5-9(6)16(13,14)12(2)15-3/h4-5H,11H2,1-3H3 |
| InChIKey | WLGCRMHPTZORLY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|