C9H12F3N3O2S — CID 79896908
5-amino-2-methyl-3-(2,2,2-trifluoroethylamino)benzenesulfonamide (PubChem CID 79896908) has the molecular formula C9H12F3N3O2S and a molecular weight of 283.28 g/mol. Its IUPAC name is 5-amino-2-methyl-3-(2,2,2-trifluoroethylamino)benzenesulfonamide.
| Compound Name | 5-amino-2-methyl-3-(2,2,2-trifluoroethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 79896908 |
| Molecular Formula | C9H12F3N3O2S |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 5-amino-2-methyl-3-(2,2,2-trifluoroethylamino)benzenesulfonamide |
| SMILES | Cc1c(NCC(F)(F)F)cc(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C9H12F3N3O2S/c1-5-7(15-4-9(10,11)12)2-6(13)3-8(5)18(14,16)17/h2-3,15H,4,13H2,1H3,(H2,14,16,17) |
| InChIKey | IEGLGRCMJXYUSM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|