C11H16F3N3O2S — CID 79897199
5-amino-2-methyl-3-[methyl(3,3,3-trifluoropropyl)amino]benzenesulfonamide (PubChem CID 79897199) has the molecular formula C11H16F3N3O2S and a molecular weight of 311.33 g/mol. Its IUPAC name is 5-amino-2-methyl-3-[methyl(3,3,3-trifluoropropyl)amino]benzenesulfonamide.
| Compound Name | 5-amino-2-methyl-3-[methyl(3,3,3-trifluoropropyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 79897199 |
| Molecular Formula | C11H16F3N3O2S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 5-amino-2-methyl-3-[methyl(3,3,3-trifluoropropyl)amino]benzenesulfonamide |
| SMILES | Cc1c(N(C)CCC(F)(F)F)cc(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H16F3N3O2S/c1-7-9(17(2)4-3-11(12,13)14)5-8(15)6-10(7)20(16,18)19/h5-6H,3-4,15H2,1-2H3,(H2,16,18,19) |
| InChIKey | INMUZOFBTNLJOZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|