C13H16BrN3O2S2 — CID 79900394
5-amino-3-[(4-bromothiophen-2-yl)methyl-methylamino]-2-methylbenzenesulfonamide (PubChem CID 79900394) has the molecular formula C13H16BrN3O2S2 and a molecular weight of 390.33 g/mol. Its IUPAC name is 5-amino-3-[(4-bromothiophen-2-yl)methyl-methylamino]-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-3-[(4-bromothiophen-2-yl)methyl-methylamino]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79900394 |
| Molecular Formula | C13H16BrN3O2S2 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 5-amino-3-[(4-bromothiophen-2-yl)methyl-methylamino]-2-methylbenzenesulfonamide |
| SMILES | Cc1c(N(C)Cc2cc(Br)cs2)cc(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C13H16BrN3O2S2/c1-8-12(4-10(15)5-13(8)21(16,18)19)17(2)6-11-3-9(14)7-20-11/h3-5,7H,6,15H2,1-2H3,(H2,16,18,19) |
| InChIKey | HAWXIWOXCRJQPL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|