C12H18F3N3O2S — CID 79900414
5-amino-2-methyl-3-[propyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide (PubChem CID 79900414) has the molecular formula C12H18F3N3O2S and a molecular weight of 325.36 g/mol. Its IUPAC name is 5-amino-2-methyl-3-[propyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide.
| Compound Name | 5-amino-2-methyl-3-[propyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 79900414 |
| Molecular Formula | C12H18F3N3O2S |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 5-amino-2-methyl-3-[propyl(2,2,2-trifluoroethyl)amino]benzenesulfonamide |
| SMILES | CCCN(CC(F)(F)F)c1cc(N)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C12H18F3N3O2S/c1-3-4-18(7-12(13,14)15)10-5-9(16)6-11(8(10)2)21(17,19)20/h5-6H,3-4,7,16H2,1-2H3,(H2,17,19,20) |
| InChIKey | BEXAUOTXMRXVSE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|