C17H24ClNO2 — CID 79900456
(1R)-1-[5-chloro-2-(6-oxaspiro[4.5]decan-9-yloxy)phenyl]ethanamine (PubChem CID 79900456) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is (1R)-1-[5-chloro-2-(6-oxaspiro[4.5]decan-9-yloxy)phenyl]ethanamine.
| Compound Name | (1R)-1-[5-chloro-2-(6-oxaspiro[4.5]decan-9-yloxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 79900456 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (1R)-1-[5-chloro-2-(6-oxaspiro[4.5]decan-9-yloxy)phenyl]ethanamine |
| SMILES | C[C@@H](N)c1cc(Cl)ccc1OC1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C17H24ClNO2/c1-12(19)15-10-13(18)4-5-16(15)21-14-6-9-20-17(11-14)7-2-3-8-17/h4-5,10,12,14H,2-3,6-9,11,19H2,1H3/t12-,14?/m1/s1 |
| InChIKey | QZGHWLBMEJNRGE-PUODRLBUSA-N |
| XLogP | 4.23 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |