C15H27NO3S — CID 79902229
2-ethyl-2-(1-oxa-9-thiaspiro[5.5]undecan-4-ylamino)butanoic acid (PubChem CID 79902229) has the molecular formula C15H27NO3S and a molecular weight of 301.45 g/mol. Its IUPAC name is 2-ethyl-2-(1-oxa-9-thiaspiro[5.5]undecan-4-ylamino)butanoic acid.
| Compound Name | 2-ethyl-2-(1-oxa-9-thiaspiro[5.5]undecan-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 79902229 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-ethyl-2-(1-oxa-9-thiaspiro[5.5]undecan-4-ylamino)butanoic acid |
| SMILES | CCC(CC)(NC1CCOC2(CCSCC2)C1)C(=O)O |
| InChI | InChI=1S/C15H27NO3S/c1-3-15(4-2,13(17)18)16-12-5-8-19-14(11-12)6-9-20-10-7-14/h12,16H,3-11H2,1-2H3,(H,17,18) |
| InChIKey | LSRWRUDNVKQZFR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |