C17H31NO — CID 79903322
N-(2,2-dimethylcyclohexyl)-6-oxaspiro[4.5]decan-9-amine (PubChem CID 79903322) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is N-(2,2-dimethylcyclohexyl)-6-oxaspiro[4.5]decan-9-amine.
| Compound Name | N-(2,2-dimethylcyclohexyl)-6-oxaspiro[4.5]decan-9-amine |
|---|---|
| PubChem CID | 79903322 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | N-(2,2-dimethylcyclohexyl)-6-oxaspiro[4.5]decan-9-amine |
| SMILES | CC1(C)CCCCC1NC1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C17H31NO/c1-16(2)9-4-3-7-15(16)18-14-8-12-19-17(13-14)10-5-6-11-17/h14-15,18H,3-13H2,1-2H3 |
| InChIKey | MHOKQZDHLJKSAJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |