C13H20N2O3S — CID 79903697
1-methyl-3-(6-oxa-2-thiaspiro[4.5]decan-9-ylamino)pyrrolidine-2,5-dione (PubChem CID 79903697) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 1-methyl-3-(6-oxa-2-thiaspiro[4.5]decan-9-ylamino)pyrrolidine-2,5-dione.
| Compound Name | 1-methyl-3-(6-oxa-2-thiaspiro[4.5]decan-9-ylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 79903697 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1-methyl-3-(6-oxa-2-thiaspiro[4.5]decan-9-ylamino)pyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(NC2CCOC3(CCSC3)C2)C1=O |
| InChI | InChI=1S/C13H20N2O3S/c1-15-11(16)6-10(12(15)17)14-9-2-4-18-13(7-9)3-5-19-8-13/h9-10,14H,2-8H2,1H3 |
| InChIKey | NUJIUDPQABQJHH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|