C12H13F4N3O — CID 79904277
N-methyl-1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidine-4-carboxamide (PubChem CID 79904277) has the molecular formula C12H13F4N3O and a molecular weight of 291.25 g/mol. Its IUPAC name is N-methyl-1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidine-4-carboxamide.
| Compound Name | N-methyl-1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 79904277 |
| Molecular Formula | C12H13F4N3O |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | N-methyl-1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(c2c(F)c(F)nc(F)c2F)CC1 |
| InChI | InChI=1S/C12H13F4N3O/c1-17-12(20)6-2-4-19(5-3-6)9-7(13)10(15)18-11(16)8(9)14/h6H,2-5H2,1H3,(H,17,20) |
| InChIKey | LSIHXGOFNAIXBJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|