C11H13F4N3O — CID 79904409
N-propyl-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanamide (PubChem CID 79904409) has the molecular formula C11H13F4N3O and a molecular weight of 279.24 g/mol. Its IUPAC name is N-propyl-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanamide.
| Compound Name | N-propyl-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanamide |
|---|---|
| PubChem CID | 79904409 |
| Molecular Formula | C11H13F4N3O |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-propyl-3-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanamide |
| SMILES | CCCNC(=O)CCNc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C11H13F4N3O/c1-2-4-16-6(19)3-5-17-9-7(12)10(14)18-11(15)8(9)13/h2-5H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | KKSPKJAJALSOLV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|