C23H24N4O4 — CID 7990450
[2-[(2,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate (PubChem CID 7990450) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is [2-[(2,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate.
| Compound Name | [2-[(2,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7990450 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [2-[(2,4-dimethylphenyl)carbamoylamino]-2-oxoethyl] (E)-2-cyano-3-[4-(dimethylamino)phenyl]prop-2-enoate |
| SMILES | Cc1ccc(NC(=O)NC(=O)COC(=O)/C(C#N)=C/c2ccc(N(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C23H24N4O4/c1-15-5-10-20(16(2)11-15)25-23(30)26-21(28)14-31-22(29)18(13-24)12-17-6-8-19(9-7-17)27(3)4/h5-12H,14H2,1-4H3,(H2,25,26,28,30)/b18-12+ |
| InChIKey | DLIGIIBUYVRIMP-LDADJPATSA-N |
| XLogP | 3.17 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|