About N-butyl-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine
N-butyl-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine (PubChem CID 79904604) has the molecular formula C10H12F4N2
and a molecular weight of 236.21 g/mol. Its IUPAC name is N-butyl-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine.
Molecular Properties
| Compound Name | N-butyl-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine |
| PubChem CID | 79904604 |
| Molecular Formula | C10H12F4N2 |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | N-butyl-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine |
| SMILES | CCCCN(C)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C10H12F4N2/c1-3-4-5-16(2)8-6(11)9(13)15-10(14)7(8)12/h3-5H2,1-2H3 |
| InChIKey | MMFQXHLPEOXDHW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine?
The IUPAC name of N-butyl-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine (CID 79904604) is N-butyl-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine.
What is the SMILES notation for N-butyl-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine?
The canonical SMILES for N-butyl-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine is CCCCN(C)c1c(F)c(F)nc(F)c1F.
What is the InChIKey of N-butyl-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine?
The InChIKey is MMFQXHLPEOXDHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F4N2/c1-3-4-5-16(2)8-6(11)9(13)15-10(14)7(8)12/h3-5H2,1-2H3.
What are the key properties of N-butyl-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine?
N-butyl-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine has a molecular weight of 236.21 g/mol, XLogP of 2.87, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine is sourced from PubChem (CID 79904604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).