C10H10F4N2 — CID 79905242
N-(cyclopropylmethyl)-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine (PubChem CID 79905242) has the molecular formula C10H10F4N2 and a molecular weight of 234.20 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine.
| Compound Name | N-(cyclopropylmethyl)-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine |
|---|---|
| PubChem CID | 79905242 |
| Molecular Formula | C10H10F4N2 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-(cyclopropylmethyl)-2,3,5,6-tetrafluoro-N-methylpyridin-4-amine |
| SMILES | CN(CC1CC1)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C10H10F4N2/c1-16(4-5-2-3-5)8-6(11)9(13)15-10(14)7(8)12/h5H,2-4H2,1H3 |
| InChIKey | KOXNDXFYRDCANK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|