About 5-amino-2-methyl-3-(1,3-thiazol-2-ylsulfanyl)benzenesulfonamide
5-amino-2-methyl-3-(1,3-thiazol-2-ylsulfanyl)benzenesulfonamide (PubChem CID 79905305) has the molecular formula C10H11N3O2S3
and a molecular weight of 301.42 g/mol. Its IUPAC name is 5-amino-2-methyl-3-(1,3-thiazol-2-ylsulfanyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 5-amino-2-methyl-3-(1,3-thiazol-2-ylsulfanyl)benzenesulfonamide |
| PubChem CID | 79905305 |
| Molecular Formula | C10H11N3O2S3 |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 5-amino-2-methyl-3-(1,3-thiazol-2-ylsulfanyl)benzenesulfonamide |
| SMILES | Cc1c(Sc2nccs2)cc(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H11N3O2S3/c1-6-8(17-10-13-2-3-16-10)4-7(11)5-9(6)18(12,14)15/h2-5H,11H2,1H3,(H2,12,14,15) |
| InChIKey | MCHVUZUWHBXROE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-methyl-3-(1,3-thiazol-2-ylsulfanyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-methyl-3-(1,3-thiazol-2-ylsulfanyl)benzenesulfonamide?
The IUPAC name of 5-amino-2-methyl-3-(1,3-thiazol-2-ylsulfanyl)benzenesulfonamide (CID 79905305) is 5-amino-2-methyl-3-(1,3-thiazol-2-ylsulfanyl)benzenesulfonamide.
What is the SMILES notation for 5-amino-2-methyl-3-(1,3-thiazol-2-ylsulfanyl)benzenesulfonamide?
The canonical SMILES for 5-amino-2-methyl-3-(1,3-thiazol-2-ylsulfanyl)benzenesulfonamide is Cc1c(Sc2nccs2)cc(N)cc1S(N)(=O)=O.
What is the InChIKey of 5-amino-2-methyl-3-(1,3-thiazol-2-ylsulfanyl)benzenesulfonamide?
The InChIKey is MCHVUZUWHBXROE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2S3/c1-6-8(17-10-13-2-3-16-10)4-7(11)5-9(6)18(12,14)15/h2-5H,11H2,1H3,(H2,12,14,15).
What are the key properties of 5-amino-2-methyl-3-(1,3-thiazol-2-ylsulfanyl)benzenesulfonamide?
5-amino-2-methyl-3-(1,3-thiazol-2-ylsulfanyl)benzenesulfonamide has a molecular weight of 301.42 g/mol, XLogP of 1.83, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-methyl-3-(1,3-thiazol-2-ylsulfanyl)benzenesulfonamide is sourced from PubChem (CID 79905305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).