C15H21NOS — CID 79906014
2-methyl-3-(5-oxaspiro[3.5]nonan-8-ylsulfanyl)aniline (PubChem CID 79906014) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is 2-methyl-3-(5-oxaspiro[3.5]nonan-8-ylsulfanyl)aniline.
| Compound Name | 2-methyl-3-(5-oxaspiro[3.5]nonan-8-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 79906014 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-methyl-3-(5-oxaspiro[3.5]nonan-8-ylsulfanyl)aniline |
| SMILES | Cc1c(N)cccc1SC1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C15H21NOS/c1-11-13(16)4-2-5-14(11)18-12-6-9-17-15(10-12)7-3-8-15/h2,4-5,12H,3,6-10,16H2,1H3 |
| InChIKey | PWMZTKATLAQJAH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|